pyridine, 3,5-dibromo-2-chloro-4-methyl- - Names and Identifiers
Name | 3,5-dibromo-2-chloro-4-methylpyridine
|
Synonyms | 2-Chloro-3,5-dibromo-4-picoline 3,5-DIBROMO-2-CHLORO-4-PICOLINE 2-Chloro-3,5-dibromo-4-methylpyridine 3,5-dibromo-2-chloro-4-methylpyridine Pyridine, 3,5-dibromo-2-chloro-4-methyl- pyridine, 3,5-dibromo-2-chloro-4-methyl-
|
CAS | 1000017-92-4
|
InChI | InChI=1/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3 |
pyridine, 3,5-dibromo-2-chloro-4-methyl- - Physico-chemical Properties
Molecular Formula | C6H4Br2ClN
|
Molar Mass | 285.36 |
Density | 1.992 |
Boling Point | 285.1±35.0 °C(Predicted) |
pKa | -2.21±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Sensitive | IRRITANT |
MDL | MFCD09864796 |
Physical and Chemical Properties | Density: 1.992 |
pyridine, 3,5-dibromo-2-chloro-4-methyl- - Introduction
2-Chloro-3, 5-dibromo-4-methylpyridine is an organic compound with the chemical structure of C7H5Br2ClN.
Nature:
1. appearance: colorless or light yellow liquid.
2. Density: about 1.74 g/mL.
3. Melting point: about 20-23°C.
4. Boiling point: about 256°C.
5. Solubility: insoluble in water, soluble in organic solvents such as ethanol and chloroform.
6. stability: in the light of air and moisture instability, should be sealed to avoid light preservation.
Use:
1.2-Chloro-3, 5-dibromo-4-methylpyridine can be used as an intermediate in organic synthesis and plays an important role in the preparation of pesticides, pharmaceuticals and dyes.
2. In the field of medicine, it may have antibacterial, antiviral and anticancer activities.
3. In agriculture, it can be used to make pesticides and herbicides.
Preparation Method:
The preparation method of 2-chloro-3, 5-dibromo-4-methylpyridine can be carried out by the following steps:
1. First, 3-bromo-5-chloro-2-methylpyridine is reacted with bromine under acidic conditions.
2. The resulting product is then reacted with sodium hydroxide to generate 2-chloro-3, 5-dibromo-4-methylpyridine.
Safety Information:
1.2-Chloro-3, 5-dibromo-4-methylpyridine is irritating and should avoid contact with skin, eyes and respiratory tract.
2. in use and operation, should wear appropriate personal protective equipment, such as protective gloves, protective glasses and protective masks.
3. During storage and handling, care should be taken to prevent light and avoid contact with oxidants to avoid the risk of fire or explosion.
4. If inhaled or exposed to the compound, wash the affected area immediately and seek medical help.
Please note that chemical experiments and preparation of compounds should be carried out under the guidance of professionals to ensure safety and correctness.
Last Update:2024-04-09 21:01:54